CAS 2856018-37-4 is the registry number for (3R,4S)-tert-Butyl 3,4-dihydroxypyrrolidine-1-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate (CAS 2856018-37-4) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate. InChIKey: MAXQBMZDVBHSLW-KNVOCYPGSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate |
| InChIKey | MAXQBMZDVBHSLW-KNVOCYPGSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C1)O)O |
Computed by PubChem (NCBI)