CAS 298681-10-4 is the registry number for tert-Butyl 3,4-dihydroxypyrrolidine-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 3,4-dihydroxypyrrolidine-1-carboxylate (CAS 298681-10-4) is a chemical compound with the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. IUPAC name: tert-butyl 3,4-dihydroxypyrrolidine-1-carboxylate. InChIKey: MAXQBMZDVBHSLW-UHFFFAOYSA-N.
| Molecular formula | C9H17NO4 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | tert-butyl 3,4-dihydroxypyrrolidine-1-carboxylate |
| InChIKey | MAXQBMZDVBHSLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C(C1)O)O |
Computed by PubChem (NCBI)