CAS 285978-14-5 appears in our catalog under these names: L–Glutamine–13C5,15N2, L-Glutamine-13C5,15N2, 98% 98%atom%13C,98%atom%15N, L-Glutamine-¹³C₅,¹⁵N₂, ≥98%, ≥98%, L-Glutamine-13C5,15N2, 98.0%. Offered by: GLPBio, AmBeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 1mg, 25mg, 100mg, 1 mg, 10 mg, 5 mg.
(2S)-2,5-bis(15N)(azanyl)-5-oxo(1,2,3,4,5-13C5)pentanoic acid (CAS 285978-14-5) is a chemical compound with the molecular formula C5H10N2O3 and a molecular weight of 153.09 g/mol. IUPAC name: (2S)-2,5-bis(15N)(azanyl)-5-oxo(1,2,3,4,5-13C5)pentanoic acid. InChIKey: ZDXPYRJPNDTMRX-YIDSDQPMSA-N.
| Molecular formula | C5H10N2O3 |
|---|---|
| Molecular weight | 153.09 g/mol |
| IUPAC name | (2S)-2,5-bis(15N)(azanyl)-5-oxo(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | ZDXPYRJPNDTMRX-YIDSDQPMSA-N |
| SMILES | [13CH2]([13CH2][13C](=O)[15NH2])[13C@@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)