CAS 2863686-75-1 is the registry number for 1-(3,6-Diazabicyclo(3.1.1)heptan-3-yl)ethan-1-one 2,2,2-trifluoroacetate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
1-(3,6-diazabicyclo[3.1.1]heptan-3-yl)ethanone;2,2,2-trifluoroacetic acid (CAS 2863686-75-1) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: 1-(3,6-diazabicyclo[3.1.1]heptan-3-yl)ethanone;2,2,2-trifluoroacetic acid. InChIKey: HOYURUFKUXKHIP-UHFFFAOYSA-N.
| Molecular formula | C9H13F3N2O3 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 1-(3,6-diazabicyclo[3.1.1]heptan-3-yl)ethanone;2,2,2-trifluoroacetic acid |
| InChIKey | HOYURUFKUXKHIP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CC(C1)N2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)