Products 289044-75-3
CAS 289044-75-3 is the registry number for Ethyl (Z)-3-(Dimethylcarbamoylamino)-4,4,4-trifluoro-but-2-enoate. Offered by: TRC. Available pack sizes: 250mg.
Ethyl (Z)-3-(dimethylcarbamoylamino)-4,4,4-trifluorobut-2-enoate (CAS 289044-75-3) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: ethyl (Z)-3-(dimethylcarbamoylamino)-4,4,4-trifluorobut-2-enoate. InChIKey: LBRSMSMOPWFBCQ-WAYWQWQTSA-N.
| Molecular formula | C9H13F3N2O3 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | ethyl (Z)-3-(dimethylcarbamoylamino)-4,4,4-trifluorobut-2-enoate |
| InChIKey | LBRSMSMOPWFBCQ-WAYWQWQTSA-N |
| SMILES | CCOC(=O)/C=C(/C(F)(F)F)\NC(=O)N(C)C |
Computed by PubChem (NCBI)