CAS 1159599-97-9 is the registry number for 5-Aminomethyl-3-isopropylisoxazole trifluoroacetate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(3-propan-2-yl-1,2-oxazol-5-yl)methanamine;2,2,2-trifluoroacetic acid (CAS 1159599-97-9) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: (3-propan-2-yl-1,2-oxazol-5-yl)methanamine;2,2,2-trifluoroacetic acid. InChIKey: RWTUDSFODWLYGU-UHFFFAOYSA-N.
| Molecular formula | C9H13F3N2O3 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | (3-propan-2-yl-1,2-oxazol-5-yl)methanamine;2,2,2-trifluoroacetic acid |
| InChIKey | RWTUDSFODWLYGU-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NOC(=C1)CN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)