CAS 1706436-80-7 appears in our catalog under these names: 1-(Azetidin-3-yl)pyrrolidin-2-one trifluoro acetate, 95%, 1-(Azetidin-3-yl)pyrrolidin-2-one 2,2,2-trifluoroacetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
1-(azetidin-3-yl)pyrrolidin-2-one;2,2,2-trifluoroacetic acid (CAS 1706436-80-7) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: 1-(azetidin-3-yl)pyrrolidin-2-one;2,2,2-trifluoroacetic acid. InChIKey: AXFLEQWGWVHAQX-UHFFFAOYSA-N.
| Molecular formula | C9H13F3N2O3 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 1-(azetidin-3-yl)pyrrolidin-2-one;2,2,2-trifluoroacetic acid |
| InChIKey | AXFLEQWGWVHAQX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)