CAS 2055839-78-4 appears in our catalog under these names: 1-(2,6-Diazaspiro[3.3]heptan-2-yl)ethan-1-one trifluoroacetic acid, 95%, 1-(2,6-Diazaspiro(3.3)heptan-2-yl)ethanone 2,2,2-trifluoroacetate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g.
1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone;2,2,2-trifluoroacetic acid (CAS 2055839-78-4) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: 1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone;2,2,2-trifluoroacetic acid. InChIKey: YLTWNBGBNUDFJH-UHFFFAOYSA-N.
| Molecular formula | C9H13F3N2O3 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 1-(2,6-diazaspiro[3.3]heptan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
| InChIKey | YLTWNBGBNUDFJH-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2(C1)CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)