Products 1566649-47-5

CAS 1566649-47-5 appears in our catalog under these names: 1,7-Diazaspiro[4.4]nonan-2-one 2,2,2-trifluoroacetate, 95%, 1,7-diazaspiro(4.4)nonan-2-one tfa, 1,7-Diazaspiro[4.4]nonan-2-one 2,2,2-trifluoroacetate, 98%, 98%, 1,7-DIAZASPIRO[4.4]NONAN-2-ONE TFA, 98%, 1,7-Diazaspiro[4.4]nonan-2-one 2,2,2-trifluoroacetate, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 50mg, 0,5g, 500mg, 5g.

Structural formula: {0} (CAS {1})

1,7-diazaspiro[4.4]nonan-2-one;2,2,2-trifluoroacetic acid (CAS 1566649-47-5) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: 1,7-diazaspiro[4.4]nonan-2-one;2,2,2-trifluoroacetic acid. InChIKey: VXBWFTBSMZXDLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13F3N2O3
Molecular weight254.21 g/mol
IUPAC name1,7-diazaspiro[4.4]nonan-2-one;2,2,2-trifluoroacetic acid
InChIKeyVXBWFTBSMZXDLJ-UHFFFAOYSA-N
SMILESC1CC2(CCNC2)NC1=O.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)