Products 1210972-22-7

CAS 1210972-22-7 is the registry number for 5-Aminomethyl-3-isopropylisoxazole tfa salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(3-propan-2-yl-1,2-oxazol-5-yl)methanamine;2,2,2-trifluoroacetic acid (CAS 1210972-22-7) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: (3-propan-2-yl-1,2-oxazol-5-yl)methanamine;2,2,2-trifluoroacetic acid. InChIKey: RWTUDSFODWLYGU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13F3N2O3
Molecular weight254.21 g/mol
IUPAC name(3-propan-2-yl-1,2-oxazol-5-yl)methanamine;2,2,2-trifluoroacetic acid
InChIKeyRWTUDSFODWLYGU-UHFFFAOYSA-N
SMILESCC(C)C1=NOC(=C1)CN.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)