Products 286460-80-8
CAS 286460-80-8 is the registry number for Fmoc-Gly-OH-13C2. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 286460-80-8) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 299.29 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: NDKDFTQNXLHCGO-QZZXWHIHSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 299.29 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | NDKDFTQNXLHCGO-QZZXWHIHSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[13CH2][13C](=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Gly-OH-13C2, Fmoc-Gly-OH-13C2, 99 atom % 13C