CAS 285978-13-4 appears in our catalog under these names: Fmoc-Gly-OH-13C2,15N, FMOC-GLY-OH-13C2,15N, 99 ATOM % 13C, 98&, Fmoc-Gly-OH-13C2,15N, 99.6%. Offered by: Creative Peptides, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 500MG, 10 mg, 1 mg, 5 mg.
2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid (CAS 285978-13-4) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 300.28 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid. InChIKey: NDKDFTQNXLHCGO-KBBTWOTBSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 300.28 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)acetic acid |
| InChIKey | NDKDFTQNXLHCGO-KBBTWOTBSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)[15NH][13CH2][13C](=O)O |
Computed by PubChem (NCBI)