Products 175453-19-7
CAS 175453-19-7 is the registry number for Fmoc-Gly-OH-13C. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid (CAS 175453-19-7) is a chemical compound with the molecular formula C17H15NO4 and a molecular weight of 298.30 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid. InChIKey: NDKDFTQNXLHCGO-QBZHADDCSA-N.
| Molecular formula | C17H15NO4 |
|---|---|
| Molecular weight | 298.30 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid |
| InChIKey | NDKDFTQNXLHCGO-QBZHADDCSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[13CH2]C(=O)O |
Computed by PubChem (NCBI)