Products 2866291-16-7
CAS 2866291-16-7 is the registry number for 5-Bromo-3-chloro-2-methoxy-4-methylaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3-chloro-2-methoxy-4-methylaniline (CAS 2866291-16-7) is a chemical compound with the molecular formula C8H9BrClNO and a molecular weight of 250.52 g/mol. IUPAC name: 5-bromo-3-chloro-2-methoxy-4-methylaniline. InChIKey: SXUWBHFZFPQJTD-UHFFFAOYSA-N.
| Molecular formula | C8H9BrClNO |
|---|---|
| Molecular weight | 250.52 g/mol |
| IUPAC name | 5-bromo-3-chloro-2-methoxy-4-methylaniline |
| InChIKey | SXUWBHFZFPQJTD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=C1Cl)OC)N)Br |
Computed by PubChem (NCBI)