Products 2866352-73-8
CAS 2866352-73-8 is the registry number for 4-[(acetyloxy)methyl]-7-oxabicyclo[2.2.1]heptane-1-carboxylic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 250mg, 500mg.
4-(acetyloxymethyl)-7-oxabicyclo[2.2.1]heptane-1-carboxylic acid (CAS 2866352-73-8) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: 4-(acetyloxymethyl)-7-oxabicyclo[2.2.1]heptane-1-carboxylic acid. InChIKey: OYSPBNJKZISQNB-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 4-(acetyloxymethyl)-7-oxabicyclo[2.2.1]heptane-1-carboxylic acid |
| InChIKey | OYSPBNJKZISQNB-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CCC(O1)(CC2)C(=O)O |
Computed by PubChem (NCBI)