Products 2869880-24-8
CAS 2869880-24-8 is the registry number for (E)-3-(3-(1-(tert-Butoxycarbonyl)piperidin-4-yl)phenyl)acrylic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g.
(E)-3-[3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]prop-2-enoic acid (CAS 2869880-24-8) is a chemical compound with the molecular formula C19H25NO4 and a molecular weight of 331.4 g/mol. IUPAC name: (E)-3-[3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]prop-2-enoic acid. InChIKey: OFTOXOUZJVJKTF-BQYQJAHWSA-N.
| Molecular formula | C19H25NO4 |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | (E)-3-[3-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]phenyl]prop-2-enoic acid |
| InChIKey | OFTOXOUZJVJKTF-BQYQJAHWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)