Products 287119-83-9
CAS 287119-83-9 appears in our catalog under these names: 2-(2-Methyl-5-nitrophenyl)acetic acid, 95%, 2–(2–Methyl–5–nitrophenyl)acetic acid, 2-(2-Methyl-5-nitrophenyl)acetic acid, 95%, 95%, 2-(2-Methyl-5-nitrophenyl)acetic acid, 95+%, 2-(2-Methyl-5-nitrophenyl)acetic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-(2-methyl-5-nitrophenyl)acetic acid (CAS 287119-83-9) is a chemical compound with the molecular formula C9H9NO4 and a molecular weight of 195.17 g/mol. IUPAC name: 2-(2-methyl-5-nitrophenyl)acetic acid. InChIKey: JCSRJKWRJVUXSQ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4 |
|---|---|
| Molecular weight | 195.17 g/mol |
| IUPAC name | 2-(2-methyl-5-nitrophenyl)acetic acid |
| InChIKey | JCSRJKWRJVUXSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])CC(=O)O |
Computed by PubChem (NCBI)