Products 2873418-48-3
CAS 2873418-48-3 is the registry number for Tyrosinase-IN-10. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E)-2-[(2,4-dihydroxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one (CAS 2873418-48-3) is a chemical compound with the molecular formula C16H12O4 and a molecular weight of 268.26 g/mol. IUPAC name: (2E)-2-[(2,4-dihydroxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one. InChIKey: JXTXSXXNWUNVNR-UXBLZVDNSA-N.
| Molecular formula | C16H12O4 |
|---|---|
| Molecular weight | 268.26 g/mol |
| IUPAC name | (2E)-2-[(2,4-dihydroxyphenyl)methylidene]-4-hydroxy-3H-inden-1-one |
| InChIKey | JXTXSXXNWUNVNR-UXBLZVDNSA-N |
| SMILES | C1/C(=C\C2=C(C=C(C=C2)O)O)/C(=O)C3=C1C(=CC=C3)O |
Computed by PubChem (NCBI)