Products 2873418-52-9
CAS 2873418-52-9 is the registry number for Tyrosinase-IN-7, 99.66%. Offered by: MedChemExpress. Available pack sizes: 50 mg, 25 mg, 100 mg, 5 mg, 10 mg.
(2Z)-2-[(2,4-dihydroxyphenyl)methylidene]-7-hydroxy-1-benzofuran-3-one (CAS 2873418-52-9) is a chemical compound with the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. IUPAC name: (2Z)-2-[(2,4-dihydroxyphenyl)methylidene]-7-hydroxy-1-benzofuran-3-one. InChIKey: YYGLODWQUMPWFP-MLPAPPSSSA-N.
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | (2Z)-2-[(2,4-dihydroxyphenyl)methylidene]-7-hydroxy-1-benzofuran-3-one |
| InChIKey | YYGLODWQUMPWFP-MLPAPPSSSA-N |
| SMILES | C1=CC2=C(C(=C1)O)O/C(=C\C3=C(C=C(C=C3)O)O)/C2=O |
Computed by PubChem (NCBI)