CAS 287384-61-6 appears in our catalog under these names: 7-Chloro-1H,2H,3H,4H-pyrazino(1,2-a)indole, 95%, 7-Chloro-1H,2H,3H,4H-pyrazino(1,2-a)indole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole (CAS 287384-61-6) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 7-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole. InChIKey: PSLRQWHMXFDQNK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 7-chloro-1,2,3,4-tetrahydropyrazino[1,2-a]indole |
| InChIKey | PSLRQWHMXFDQNK-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC3=C2C=C(C=C3)Cl)CN1 |
Computed by PubChem (NCBI)