CAS 287389-48-4 is the registry number for 2-Phenylphenol-13C6. Offered by: TRC. Available pack sizes: 25mg.
2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)phenol (CAS 287389-48-4) is a chemical compound with the molecular formula C12H10O and a molecular weight of 176.16 g/mol. IUPAC name: 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)phenol. InChIKey: LLEMOWNGBBNAJR-QBTRQFLCSA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 2-((1,2,3,4,5,6-13C6)cyclohexatrienyl)phenol |
| InChIKey | LLEMOWNGBBNAJR-QBTRQFLCSA-N |
| SMILES | C1=CC=C(C(=C1)[13C]2=[13CH][13CH]=[13CH][13CH]=[13CH]2)O |
Computed by PubChem (NCBI)