CAS 28819-05-8 appears in our catalog under these names: Z–Ala–OMe, Z-Ala-OMe 98%, Cbz-Ala-OMe, 98%, 98%, Z-Ala-OMe, 99.76%, Z-L-alanine methyl ester, min. 95 %, 10 g. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Roth. Available pack sizes: 100g, 1g, 5g, 10g, 25g, 500g, 25 g, 100 g.
Methyl (2S)-2-(phenylmethoxycarbonylamino)propanoate (CAS 28819-05-8) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: methyl (2S)-2-(phenylmethoxycarbonylamino)propanoate. InChIKey: OMDVFTVXPVXANK-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | methyl (2S)-2-(phenylmethoxycarbonylamino)propanoate |
| InChIKey | OMDVFTVXPVXANK-VIFPVBQESA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)