CAS 2883431-12-5 is the registry number for Methyl 5-cyclopropyl-4-hydroxy-1H-pyrazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-cyclopropyl-4-hydroxy-1H-pyrazole-5-carboxylate (CAS 2883431-12-5) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: methyl 3-cyclopropyl-4-hydroxy-1H-pyrazole-5-carboxylate. InChIKey: NXLNIFYXCKAXQJ-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | methyl 3-cyclopropyl-4-hydroxy-1H-pyrazole-5-carboxylate |
| InChIKey | NXLNIFYXCKAXQJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=NN1)C2CC2)O |
Computed by PubChem (NCBI)