CAS 2888659-45-6 is the registry number for 1-(4-Chloropyrazolo[1,5-a]pyrazin-2-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chloropyrazolo[1,5-a]pyrazin-2-yl)ethanone (CAS 2888659-45-6) is a chemical compound with the molecular formula C8H6ClN3O and a molecular weight of 195.60 g/mol. IUPAC name: 1-(4-chloropyrazolo[1,5-a]pyrazin-2-yl)ethanone. InChIKey: JBPPJUNCQZOHRU-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 1-(4-chloropyrazolo[1,5-a]pyrazin-2-yl)ethanone |
| InChIKey | JBPPJUNCQZOHRU-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=NN2C=CN=C(C2=C1)Cl |
Computed by PubChem (NCBI)