Products 2891579-92-1
CAS 2891579-92-1 is the registry number for O1-tert-butyl O2-methyl (2R,3R)-3-ethylpyrrolidine-1,2-dicarboxylate, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 2-O-methyl (2R,3R)-3-ethylpyrrolidine-1,2-dicarboxylate (CAS 2891579-92-1) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,3R)-3-ethylpyrrolidine-1,2-dicarboxylate. InChIKey: ZHUREJPADLSAJN-NXEZZACHSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,3R)-3-ethylpyrrolidine-1,2-dicarboxylate |
| InChIKey | ZHUREJPADLSAJN-NXEZZACHSA-N |
| SMILES | CC[C@@H]1CCN([C@H]1C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)