Products 2891581-62-5
CAS 2891581-62-5 is the registry number for (R)-1-(benzyloxy)-5-oxopyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3R)-5-oxo-1-phenylmethoxypyrrolidine-3-carboxylic acid (CAS 2891581-62-5) is a chemical compound with the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. IUPAC name: (3R)-5-oxo-1-phenylmethoxypyrrolidine-3-carboxylic acid. InChIKey: WDFHLEMSQSCONQ-SNVBAGLBSA-N.
| Molecular formula | C12H13NO4 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | (3R)-5-oxo-1-phenylmethoxypyrrolidine-3-carboxylic acid |
| InChIKey | WDFHLEMSQSCONQ-SNVBAGLBSA-N |
| SMILES | C1[C@H](CN(C1=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)