Products 2891597-83-2
CAS 2891597-83-2 is the registry number for methyl 2-[1-(benzenesulfonyl)indolin-5-yl]acetate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]acetate (CAS 2891597-83-2) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: methyl 2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]acetate. InChIKey: KNBFBOOURMYBTP-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | methyl 2-[1-(benzenesulfonyl)-2,3-dihydroindol-5-yl]acetate |
| InChIKey | KNBFBOOURMYBTP-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC2=C(C=C1)N(CC2)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)