Products 2892235-54-8
CAS 2892235-54-8 is the registry number for photoCORM-2, 99.62%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg, 50 mg.
4-(9-ethylcarbazol-3-yl)-1,3-dioxol-2-one (CAS 2892235-54-8) is a chemical compound with the molecular formula C17H13NO3 and a molecular weight of 279.29 g/mol. IUPAC name: 4-(9-ethylcarbazol-3-yl)-1,3-dioxol-2-one. InChIKey: LNWWMBPIOGTCRZ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO3 |
|---|---|
| Molecular weight | 279.29 g/mol |
| IUPAC name | 4-(9-ethylcarbazol-3-yl)-1,3-dioxol-2-one |
| InChIKey | LNWWMBPIOGTCRZ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)C3=COC(=O)O3)C4=CC=CC=C41 |
Computed by PubChem (NCBI)
Synonyms:
photoCORM-2, orb1744517