Products 2899346-20-2
CAS 2899346-20-2 is the registry number for Methyl 3,3-dimethyl-2,3-dihydrofuro[3,2-b]pyridine-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3,3-dimethyl-2H-furo[3,2-b]pyridine-5-carboxylate (CAS 2899346-20-2) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: methyl 3,3-dimethyl-2H-furo[3,2-b]pyridine-5-carboxylate. InChIKey: ZBDPGNICSGLFNX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | methyl 3,3-dimethyl-2H-furo[3,2-b]pyridine-5-carboxylate |
| InChIKey | ZBDPGNICSGLFNX-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C1N=C(C=C2)C(=O)OC)C |
Computed by PubChem (NCBI)