Products 2901082-48-0
CAS 2901082-48-0 is the registry number for 1-(6-Bromo-2-fluoro-3-hydroxyphenyl)-2,2-difluoroethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(6-bromo-2-fluoro-3-hydroxyphenyl)-2,2-difluoroethanone (CAS 2901082-48-0) is a chemical compound with the molecular formula C8H4BrF3O2 and a molecular weight of 269.01 g/mol. IUPAC name: 1-(6-bromo-2-fluoro-3-hydroxyphenyl)-2,2-difluoroethanone. InChIKey: JZADVVBNAZWYGZ-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF3O2 |
|---|---|
| Molecular weight | 269.01 g/mol |
| IUPAC name | 1-(6-bromo-2-fluoro-3-hydroxyphenyl)-2,2-difluoroethanone |
| InChIKey | JZADVVBNAZWYGZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)F)C(=O)C(F)F)Br |
Computed by PubChem (NCBI)