Products 2901103-60-2
CAS 2901103-60-2 is the registry number for Methyl 4-((2-hydroxy-1-phenylethyl)carbamoyl)cubane-1-carboxylate, 97%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 4-[(2-hydroxy-1-phenylethyl)carbamoyl]cubane-1-carboxylate (CAS 2901103-60-2) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: methyl 4-[(2-hydroxy-1-phenylethyl)carbamoyl]cubane-1-carboxylate. InChIKey: XCYQGBSNMOMZEX-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | methyl 4-[(2-hydroxy-1-phenylethyl)carbamoyl]cubane-1-carboxylate |
| InChIKey | XCYQGBSNMOMZEX-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45C(=O)NC(CO)C6=CC=CC=C6 |
Computed by PubChem (NCBI)