Products 29027-42-7
CAS 29027-42-7 is the registry number for 1-(5-Chloro-2,3-dihydro-1-benzofuran-2-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylazanium chloride (CAS 29027-42-7) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylazanium chloride. InChIKey: DNMZYYCWJWLGDJ-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)methylazanium chloride |
| InChIKey | DNMZYYCWJWLGDJ-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C1C=C(C=C2)Cl)C[NH3+].[Cl-] |
Computed by PubChem (NCBI)