CAS 2903-48-2 appears in our catalog under these names: 2,6-Dimethylanilino(oxo)acetic acid, min. 95 %, 5 g, Lidocaine Impurity 5, ((2,6–Dimethylphenyl)amino)(oxo)acetic Acid, 2,6-Dimethylanilino(oxo)acetic acid, [(2,6-Dimethylphenyl)amino](oxo)acetic Acid, >98.0%(HPLC)(T). Offered by: Roth, Chemat Brand, GLPBio, Biosynth, TCI. Available pack sizes: 5g, on request, 1g, 250mg, 25g, 10g, 50g, 100g.
2-(2,6-dimethylanilino)-2-oxoacetic acid (CAS 2903-48-2) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 2-(2,6-dimethylanilino)-2-oxoacetic acid. InChIKey: JFTAPSBIODPQJN-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 2-(2,6-dimethylanilino)-2-oxoacetic acid |
| InChIKey | JFTAPSBIODPQJN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC(=O)C(=O)O |
Computed by PubChem (NCBI)