Products 2906227-87-8
CAS 2906227-87-8 appears in our catalog under these names: 5–PT formic, 5-PT (formic), 99.91%, 5-PT (formic), 99.84%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 50 mg, 10 mg, 5 mg, 25 mg.
Formic acid;2-(5-prop-2-ynoxy-1H-indol-3-yl)ethanamine (CAS 2906227-87-8) is a chemical compound with the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. IUPAC name: formic acid;2-(5-prop-2-ynoxy-1H-indol-3-yl)ethanamine. InChIKey: IVQZPPBHGZJPLF-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O3 |
|---|---|
| Molecular weight | 260.29 g/mol |
| IUPAC name | formic acid;2-(5-prop-2-ynoxy-1H-indol-3-yl)ethanamine |
| InChIKey | IVQZPPBHGZJPLF-UHFFFAOYSA-N |
| SMILES | C#CCOC1=CC2=C(C=C1)NC=C2CCN.C(=O)O |
Computed by PubChem (NCBI)