Products 2918775-50-3
CAS 2918775-50-3 is the registry number for Ethyl trans-2-(5-Bromo-3-indolyl)cyclopropanecarboxylate, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Trans-ethyl (1R,2R)-2-(5-bromo-1H-indol-3-yl)cyclopropane-1-carboxylate (CAS 2918775-50-3) is a chemical compound with the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. IUPAC name: trans-ethyl (1R,2R)-2-(5-bromo-1H-indol-3-yl)cyclopropane-1-carboxylate. InChIKey: DUGBQVXNEMUSFF-MWLCHTKSSA-N.
| Molecular formula | C14H14BrNO2 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | trans-ethyl (1R,2R)-2-(5-bromo-1H-indol-3-yl)cyclopropane-1-carboxylate |
| InChIKey | DUGBQVXNEMUSFF-MWLCHTKSSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C2=CNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)