Products 2918863-48-4
CAS 2918863-48-4 is the registry number for 1-(2,3-dichloropyridin-4-yl)-2-methylpropan-1-ol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
1-(2,3-dichloro-4-pyridinyl)-2-methylpropan-1-ol (CAS 2918863-48-4) is a chemical compound with the molecular formula C9H11Cl2NO and a molecular weight of 220.09 g/mol. IUPAC name: 1-(2,3-dichloro-4-pyridinyl)-2-methylpropan-1-ol. InChIKey: RYQVLNIBTHVOMI-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2NO |
|---|---|
| Molecular weight | 220.09 g/mol |
| IUPAC name | 1-(2,3-dichloro-4-pyridinyl)-2-methylpropan-1-ol |
| InChIKey | RYQVLNIBTHVOMI-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=C(C(=NC=C1)Cl)Cl)O |
Computed by PubChem (NCBI)