Products 2918909-53-0
CAS 2918909-53-0 is the registry number for 1-(2,5-difluoro-4-methoxyphenyl)cyclobutanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2,5-difluoro-4-methoxyphenyl)cyclobutan-1-ol (CAS 2918909-53-0) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: 1-(2,5-difluoro-4-methoxyphenyl)cyclobutan-1-ol. InChIKey: ICWMNQZOCJUUIJ-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | 1-(2,5-difluoro-4-methoxyphenyl)cyclobutan-1-ol |
| InChIKey | ICWMNQZOCJUUIJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)C2(CCC2)O)F |
Computed by PubChem (NCBI)