Products 2920404-85-7
CAS 2920404-85-7 is the registry number for dimethyl 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Dimethyl 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylate (CAS 2920404-85-7) is a chemical compound with the molecular formula C10H14O5 and a molecular weight of 214.21 g/mol. IUPAC name: dimethyl 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylate. InChIKey: KZUIOBUCVHOGFK-UHFFFAOYSA-N.
| Molecular formula | C10H14O5 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | dimethyl 3-oxabicyclo[3.1.1]heptane-1,5-dicarboxylate |
| InChIKey | KZUIOBUCVHOGFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C12CC(C1)(COC2)C(=O)OC |
Computed by PubChem (NCBI)