CAS 2922439-33-4 appears in our catalog under these names: tert-Butyl (1S,5S)-2,6-diazabicyclo(3.2.0)heptane-2-carboxylate hydrochloride, 98%, tert-Butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
Tert-butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate;hydrochloride (CAS 2922439-33-4) is a chemical compound with the molecular formula C10H19ClN2O2 and a molecular weight of 234.72 g/mol. IUPAC name: tert-butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate;hydrochloride. InChIKey: KMKIRPQCTFXVAD-WSZWBAFRSA-N.
| Molecular formula | C10H19ClN2O2 |
|---|---|
| Molecular weight | 234.72 g/mol |
| IUPAC name | tert-butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-2-carboxylate;hydrochloride |
| InChIKey | KMKIRPQCTFXVAD-WSZWBAFRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H]1CN2.Cl |
Computed by PubChem (NCBI)