Products 2924824-52-0
CAS 2924824-52-0 is the registry number for 3-((2,3-Difluorobenzyl)oxy)azetidine hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-[(2,3-difluorophenyl)methoxy]azetidine;hydrochloride (CAS 2924824-52-0) is a chemical compound with the molecular formula C10H12ClF2NO and a molecular weight of 235.66 g/mol. IUPAC name: 3-[(2,3-difluorophenyl)methoxy]azetidine;hydrochloride. InChIKey: PLPXSTBGECMNOE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2NO |
|---|---|
| Molecular weight | 235.66 g/mol |
| IUPAC name | 3-[(2,3-difluorophenyl)methoxy]azetidine;hydrochloride |
| InChIKey | PLPXSTBGECMNOE-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OCC2=C(C(=CC=C2)F)F.Cl |
Computed by PubChem (NCBI)