Products 2925084-49-5
CAS 2925084-49-5 is the registry number for CRBN ligand-742. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-4-carboxylic acid (CAS 2925084-49-5) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 6-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-4-carboxylic acid. InChIKey: YDGLZHJOMCRKBZ-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 6-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-4-carboxylic acid |
| InChIKey | YDGLZHJOMCRKBZ-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C(C=C(C=C21)N3CCC(=O)NC3=O)C(=O)O |
Computed by PubChem (NCBI)