Products 2925092-62-0
CAS 2925092-62-0 is the registry number for CRBN ligand-568. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[5-(2,4-dioxo-1,3-diazinan-1-yl)indol-1-yl]acetic acid (CAS 2925092-62-0) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 2-[5-(2,4-dioxo-1,3-diazinan-1-yl)indol-1-yl]acetic acid. InChIKey: YYJMHTWBSUDHOI-UHFFFAOYSA-N.
| Molecular formula | C14H13N3O4 |
|---|---|
| Molecular weight | 287.27 g/mol |
| IUPAC name | 2-[5-(2,4-dioxo-1,3-diazinan-1-yl)indol-1-yl]acetic acid |
| InChIKey | YYJMHTWBSUDHOI-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)N(C=C3)CC(=O)O |
Computed by PubChem (NCBI)