Products 2925093-80-5

CAS 2925093-80-5 is the registry number for CRBN ligand-739. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

5-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-7-carboxylic acid (CAS 2925093-80-5) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 5-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-7-carboxylic acid. InChIKey: UKVAMMQGRZVKEF-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13N3O4
Molecular weight287.27 g/mol
IUPAC name5-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-7-carboxylic acid
InChIKeyUKVAMMQGRZVKEF-UHFFFAOYSA-N
SMILESCN1C=CC2=CC(=CC(=C21)C(=O)O)N3CCC(=O)NC3=O

Computed by PubChem (NCBI)