Products 2925097-56-7

CAS 2925097-56-7 is the registry number for CRBN ligand-737. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-7-carboxylic acid (CAS 2925097-56-7) is a chemical compound with the molecular formula C14H13N3O4 and a molecular weight of 287.27 g/mol. IUPAC name: 4-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-7-carboxylic acid. InChIKey: YXSKLNFLHCHWBG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13N3O4
Molecular weight287.27 g/mol
IUPAC name4-(2,4-dioxo-1,3-diazinan-1-yl)-1-methylindole-7-carboxylic acid
InChIKeyYXSKLNFLHCHWBG-UHFFFAOYSA-N
SMILESCN1C=CC2=C(C=CC(=C21)C(=O)O)N3CCC(=O)NC3=O

Computed by PubChem (NCBI)