CAS 29270-33-5 appears in our catalog under these names: Alpha-bromo-4-fluorophenylacetic acid, 96%, α-Bromo-4-fluorophenylacetic acid, 95%, 95%, 2-Bromo-2-(4-fluorophenyl)acetic acid, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 10g, 25g, 1g, 5g, 250mg.
2-bromo-2-(4-fluorophenyl)acetic acid (CAS 29270-33-5) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-bromo-2-(4-fluorophenyl)acetic acid. InChIKey: ATILMAUMZRFROS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-bromo-2-(4-fluorophenyl)acetic acid |
| InChIKey | ATILMAUMZRFROS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(=O)O)Br)F |
Computed by PubChem (NCBI)