CAS 292851-43-5 is the registry number for 3-Hydroxy-5-methoxy-3-methyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-hydroxy-5-methoxy-3-methyl-1H-indol-2-one (CAS 292851-43-5) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: 3-hydroxy-5-methoxy-3-methyl-1H-indol-2-one. InChIKey: TWCABXFOQIXCBQ-UHFFFAOYSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | 3-hydroxy-5-methoxy-3-methyl-1H-indol-2-one |
| InChIKey | TWCABXFOQIXCBQ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)OC)NC1=O)O |
Computed by PubChem (NCBI)