Products 2929308-82-5

CAS 2929308-82-5 is the registry number for 4-Methyl-2-nitrostilbene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-methyl-2-nitro-1-[(E)-2-phenylethenyl]benzene (CAS 2929308-82-5) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 4-methyl-2-nitro-1-[(E)-2-phenylethenyl]benzene. InChIKey: FVHAUPFBKYTADV-CSKARUKUSA-N.

Identity
Molecular formulaC15H13NO2
Molecular weight239.27 g/mol
IUPAC name4-methyl-2-nitro-1-[(E)-2-phenylethenyl]benzene
InChIKeyFVHAUPFBKYTADV-CSKARUKUSA-N
SMILESCC1=CC(=C(C=C1)/C=C/C2=CC=CC=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)