CAS 2929308-82-5 is the registry number for 4-Methyl-2-nitrostilbene, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
4-methyl-2-nitro-1-[(E)-2-phenylethenyl]benzene (CAS 2929308-82-5) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 4-methyl-2-nitro-1-[(E)-2-phenylethenyl]benzene. InChIKey: FVHAUPFBKYTADV-CSKARUKUSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 4-methyl-2-nitro-1-[(E)-2-phenylethenyl]benzene |
| InChIKey | FVHAUPFBKYTADV-CSKARUKUSA-N |
| SMILES | CC1=CC(=C(C=C1)/C=C/C2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)