Products 2938997-58-9
CAS 2938997-58-9 is the registry number for N-(2,6-Dimethyl-5-benzofuryl)-4-methoxybenzenesulfonamide, ≥95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
N-(2,6-dimethyl-1-benzofuran-5-yl)-4-methoxybenzenesulfonamide (CAS 2938997-58-9) is a chemical compound with the molecular formula C17H17NO4S and a molecular weight of 331.4 g/mol. IUPAC name: N-(2,6-dimethyl-1-benzofuran-5-yl)-4-methoxybenzenesulfonamide. InChIKey: MPBNDIUGRMMKGK-UHFFFAOYSA-N.
| Molecular formula | C17H17NO4S |
|---|---|
| Molecular weight | 331.4 g/mol |
| IUPAC name | N-(2,6-dimethyl-1-benzofuran-5-yl)-4-methoxybenzenesulfonamide |
| InChIKey | MPBNDIUGRMMKGK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(O2)C)C=C1NS(=O)(=O)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)