Products 2939000-37-8
CAS 2939000-37-8 is the registry number for 2-[3-(Benzyloxy)-4-bromophenyl]acetonitrile, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2-(4-bromo-3-phenylmethoxyphenyl)acetonitrile (CAS 2939000-37-8) is a chemical compound with the molecular formula C15H12BrNO and a molecular weight of 302.16 g/mol. IUPAC name: 2-(4-bromo-3-phenylmethoxyphenyl)acetonitrile. InChIKey: QRYHRUCFEDZRRW-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNO |
|---|---|
| Molecular weight | 302.16 g/mol |
| IUPAC name | 2-(4-bromo-3-phenylmethoxyphenyl)acetonitrile |
| InChIKey | QRYHRUCFEDZRRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=CC(=C2)CC#N)Br |
Computed by PubChem (NCBI)