Products 2940951-05-1
CAS 2940951-05-1 appears in our catalog under these names: 2-(2-chloro-4-pyridyl)morpholine,hydrochloride, 97%, 97%, 2-(2-chloro-4-pyridyl)morpholine,hydrochloride, 97%. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-(2-chloro-4-pyridinyl)morpholine;hydrochloride (CAS 2940951-05-1) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: 2-(2-chloro-4-pyridinyl)morpholine;hydrochloride. InChIKey: NPWNYWAXUHMOEM-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | 2-(2-chloro-4-pyridinyl)morpholine;hydrochloride |
| InChIKey | NPWNYWAXUHMOEM-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC(=NC=C2)Cl.Cl |
Computed by PubChem (NCBI)